C18H25ClIN5OS — CID 111882722
N-[2-[[N'-[2-(2-chlorophenyl)ethyl]-N-ethylcarbamimidoyl]amino]ethyl]-4-methyl-1,3-thiazole-5-carboxamide;hydroiodide (PubChem CID 111882722) has the molecular formula C18H25ClIN5OS and a molecular weight of 521.86 g/mol. Its IUPAC name is N-[2-[[N'-[2-(2-chlorophenyl)ethyl]-N-ethylcarbamimidoyl]amino]ethyl]-4-methyl-1,3-thiazole-5-carboxamide;hydroiodide.
| Compound Name | N-[2-[[N'-[2-(2-chlorophenyl)ethyl]-N-ethylcarbamimidoyl]amino]ethyl]-4-methyl-1,3-thiazole-5-carboxamide;hydroiodide |
|---|---|
| PubChem CID | 111882722 |
| Molecular Formula | C18H25ClIN5OS |
| Molecular Weight | 521.86 g/mol |
| Exact Mass | 521.05 |
| IUPAC Name | N-[2-[[N'-[2-(2-chlorophenyl)ethyl]-N-ethylcarbamimidoyl]amino]ethyl]-4-methyl-1,3-thiazole-5-carboxamide;hydroiodide |
| SMILES | CCN/C(=N\CCc1ccccc1Cl)NCCNC(=O)c1scnc1C.I |
| InChI | InChI=1S/C18H24ClN5OS.HI/c1-3-20-18(22-9-8-14-6-4-5-7-15(14)19)23-11-10-21-17(25)16-13(2)24-12-26-16;/h4-7,12H,3,8-11H2,1-2H3,(H,21,25)(H2,20,22,23);1H |
| InChIKey | KDDPNXXCYBBYGN-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 78.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.86 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|