C20H25Cl2IN4O — CID 111882398
2-chloro-N-[2-[[N'-[2-(2-chlorophenyl)ethyl]-N-ethylcarbamimidoyl]amino]ethyl]benzamide;hydroiodide (PubChem CID 111882398) has the molecular formula C20H25Cl2IN4O and a molecular weight of 535.26 g/mol. Its IUPAC name is 2-chloro-N-[2-[[N'-[2-(2-chlorophenyl)ethyl]-N-ethylcarbamimidoyl]amino]ethyl]benzamide;hydroiodide.
| Compound Name | 2-chloro-N-[2-[[N'-[2-(2-chlorophenyl)ethyl]-N-ethylcarbamimidoyl]amino]ethyl]benzamide;hydroiodide |
|---|---|
| PubChem CID | 111882398 |
| Molecular Formula | C20H25Cl2IN4O |
| Molecular Weight | 535.26 g/mol |
| Exact Mass | 534.05 |
| IUPAC Name | 2-chloro-N-[2-[[N'-[2-(2-chlorophenyl)ethyl]-N-ethylcarbamimidoyl]amino]ethyl]benzamide;hydroiodide |
| SMILES | CCN/C(=N\CCc1ccccc1Cl)NCCNC(=O)c1ccccc1Cl.I |
| InChI | InChI=1S/C20H24Cl2N4O.HI/c1-2-23-20(25-12-11-15-7-3-5-9-17(15)21)26-14-13-24-19(27)16-8-4-6-10-18(16)22;/h3-10H,2,11-14H2,1H3,(H,24,27)(H2,23,25,26);1H |
| InChIKey | SPPSRHBHQXNPQL-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.26 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|