C14H23ClIN3 — CID 111227932
1-[2-(2-chlorophenyl)ethyl]-3-ethyl-2-propylguanidine;hydroiodide (PubChem CID 111227932) has the molecular formula C14H23ClIN3 and a molecular weight of 395.72 g/mol. Its IUPAC name is 1-[2-(2-chlorophenyl)ethyl]-3-ethyl-2-propylguanidine;hydroiodide.
| Compound Name | 1-[2-(2-chlorophenyl)ethyl]-3-ethyl-2-propylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111227932 |
| Molecular Formula | C14H23ClIN3 |
| Molecular Weight | 395.72 g/mol |
| Exact Mass | 395.06 |
| IUPAC Name | 1-[2-(2-chlorophenyl)ethyl]-3-ethyl-2-propylguanidine;hydroiodide |
| SMILES | CCC/N=C(\NCC)NCCc1ccccc1Cl.I |
| InChI | InChI=1S/C14H22ClN3.HI/c1-3-10-17-14(16-4-2)18-11-9-12-7-5-6-8-13(12)15;/h5-8H,3-4,9-11H2,1-2H3,(H2,16,17,18);1H |
| InChIKey | IWCCXZADKGSCAS-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.72 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|