C21H29ClIN3O3 — CID 111368310
1-[2-(2-chlorophenyl)ethyl]-3-ethyl-2-[(2,4,5-trimethoxyphenyl)methyl]guanidine;hydroiodide (PubChem CID 111368310) has the molecular formula C21H29ClIN3O3 and a molecular weight of 533.84 g/mol. Its IUPAC name is 1-[2-(2-chlorophenyl)ethyl]-3-ethyl-2-[(2,4,5-trimethoxyphenyl)methyl]guanidine;hydroiodide.
| Compound Name | 1-[2-(2-chlorophenyl)ethyl]-3-ethyl-2-[(2,4,5-trimethoxyphenyl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111368310 |
| Molecular Formula | C21H29ClIN3O3 |
| Molecular Weight | 533.84 g/mol |
| Exact Mass | 533.09 |
| IUPAC Name | 1-[2-(2-chlorophenyl)ethyl]-3-ethyl-2-[(2,4,5-trimethoxyphenyl)methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1cc(OC)c(OC)cc1OC)NCCc1ccccc1Cl.I |
| InChI | InChI=1S/C21H28ClN3O3.HI/c1-5-23-21(24-11-10-15-8-6-7-9-17(15)22)25-14-16-12-19(27-3)20(28-4)13-18(16)26-2;/h6-9,12-13H,5,10-11,14H2,1-4H3,(H2,23,24,25);1H |
| InChIKey | FCHWFKXCYRQHAQ-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.84 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|