C19H32ClN5O2 — CID 111652902
2-chloro-N-[2-[[N-ethyl-N'-[2-[3-methoxypropyl(methyl)amino]ethyl]carbamimidoyl]amino]ethyl]benzamide (PubChem CID 111652902) has the molecular formula C19H32ClN5O2 and a molecular weight of 397.95 g/mol. Its IUPAC name is 2-chloro-N-[2-[[N-ethyl-N'-[2-[3-methoxypropyl(methyl)amino]ethyl]carbamimidoyl]amino]ethyl]benzamide.
| Compound Name | 2-chloro-N-[2-[[N-ethyl-N'-[2-[3-methoxypropyl(methyl)amino]ethyl]carbamimidoyl]amino]ethyl]benzamide |
|---|---|
| PubChem CID | 111652902 |
| Molecular Formula | C19H32ClN5O2 |
| Molecular Weight | 397.95 g/mol |
| Exact Mass | 397.22 |
| IUPAC Name | 2-chloro-N-[2-[[N-ethyl-N'-[2-[3-methoxypropyl(methyl)amino]ethyl]carbamimidoyl]amino]ethyl]benzamide |
| SMILES | CCN/C(=N\CCN(C)CCCOC)NCCNC(=O)c1ccccc1Cl |
| InChI | InChI=1S/C19H32ClN5O2/c1-4-21-19(24-12-14-25(2)13-7-15-27-3)23-11-10-22-18(26)16-8-5-6-9-17(16)20/h5-6,8-9H,4,7,10-15H2,1-3H3,(H,22,26)(H2,21,23,24) |
| InChIKey | IOQHXDIJDBECKE-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 77.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.95 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|