C17H30Cl2N6O — CID 111651128
1-[2-[(3,5-dichloro-2-pyridinyl)amino]ethyl]-3-ethyl-2-[2-[3-methoxypropyl(methyl)amino]ethyl]guanidine (PubChem CID 111651128) has the molecular formula C17H30Cl2N6O and a molecular weight of 405.37 g/mol. Its IUPAC name is 1-[2-[(3,5-dichloro-2-pyridinyl)amino]ethyl]-3-ethyl-2-[2-[3-methoxypropyl(methyl)amino]ethyl]guanidine.
| Compound Name | 1-[2-[(3,5-dichloro-2-pyridinyl)amino]ethyl]-3-ethyl-2-[2-[3-methoxypropyl(methyl)amino]ethyl]guanidine |
|---|---|
| PubChem CID | 111651128 |
| Molecular Formula | C17H30Cl2N6O |
| Molecular Weight | 405.37 g/mol |
| Exact Mass | 404.19 |
| IUPAC Name | 1-[2-[(3,5-dichloro-2-pyridinyl)amino]ethyl]-3-ethyl-2-[2-[3-methoxypropyl(methyl)amino]ethyl]guanidine |
| SMILES | CCN/C(=N\CCN(C)CCCOC)NCCNc1ncc(Cl)cc1Cl |
| InChI | InChI=1S/C17H30Cl2N6O/c1-4-20-17(23-8-10-25(2)9-5-11-26-3)22-7-6-21-16-15(19)12-14(18)13-24-16/h12-13H,4-11H2,1-3H3,(H,21,24)(H2,20,22,23) |
| InChIKey | QUHVSKLZSXAFDD-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 73.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.37 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|