C16H28Cl2IN5O2 — CID 111405856
1-[2-[(3,5-dichloro-2-pyridinyl)amino]ethyl]-3-ethyl-2-[3-(2-methoxyethoxy)propyl]guanidine;hydroiodide (PubChem CID 111405856) has the molecular formula C16H28Cl2IN5O2 and a molecular weight of 520.24 g/mol. Its IUPAC name is 1-[2-[(3,5-dichloro-2-pyridinyl)amino]ethyl]-3-ethyl-2-[3-(2-methoxyethoxy)propyl]guanidine;hydroiodide.
| Compound Name | 1-[2-[(3,5-dichloro-2-pyridinyl)amino]ethyl]-3-ethyl-2-[3-(2-methoxyethoxy)propyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111405856 |
| Molecular Formula | C16H28Cl2IN5O2 |
| Molecular Weight | 520.24 g/mol |
| Exact Mass | 519.07 |
| IUPAC Name | 1-[2-[(3,5-dichloro-2-pyridinyl)amino]ethyl]-3-ethyl-2-[3-(2-methoxyethoxy)propyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CCCOCCOC)NCCNc1ncc(Cl)cc1Cl.I |
| InChI | InChI=1S/C16H27Cl2N5O2.HI/c1-3-19-16(21-5-4-8-25-10-9-24-2)22-7-6-20-15-14(18)11-13(17)12-23-15;/h11-12H,3-10H2,1-2H3,(H,20,23)(H2,19,21,22);1H |
| InChIKey | PJHHZRRNTCHFFS-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 79.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.24 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|