C14H31N3O4 — CID 111404627
1-ethyl-3-[2-(2-methoxyethoxy)ethyl]-2-[3-(2-methoxyethoxy)propyl]guanidine (PubChem CID 111404627) has the molecular formula C14H31N3O4 and a molecular weight of 305.42 g/mol. Its IUPAC name is 1-ethyl-3-[2-(2-methoxyethoxy)ethyl]-2-[3-(2-methoxyethoxy)propyl]guanidine.
| Compound Name | 1-ethyl-3-[2-(2-methoxyethoxy)ethyl]-2-[3-(2-methoxyethoxy)propyl]guanidine |
|---|---|
| PubChem CID | 111404627 |
| Molecular Formula | C14H31N3O4 |
| Molecular Weight | 305.42 g/mol |
| Exact Mass | 305.23 |
| IUPAC Name | 1-ethyl-3-[2-(2-methoxyethoxy)ethyl]-2-[3-(2-methoxyethoxy)propyl]guanidine |
| SMILES | CCN/C(=N\CCCOCCOC)NCCOCCOC |
| InChI | InChI=1S/C14H31N3O4/c1-4-15-14(17-7-9-21-13-11-19-3)16-6-5-8-20-12-10-18-2/h4-13H2,1-3H3,(H2,15,16,17) |
| InChIKey | QVUOGZWFPZTYRW-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.42 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|