C17H36N4O2 — CID 111406971
1-ethyl-2-[3-(2-methoxyethoxy)propyl]-3-(4-pyrrolidin-1-ylbutyl)guanidine (PubChem CID 111406971) has the molecular formula C17H36N4O2 and a molecular weight of 328.50 g/mol. Its IUPAC name is 1-ethyl-2-[3-(2-methoxyethoxy)propyl]-3-(4-pyrrolidin-1-ylbutyl)guanidine.
| Compound Name | 1-ethyl-2-[3-(2-methoxyethoxy)propyl]-3-(4-pyrrolidin-1-ylbutyl)guanidine |
|---|---|
| PubChem CID | 111406971 |
| Molecular Formula | C17H36N4O2 |
| Molecular Weight | 328.50 g/mol |
| Exact Mass | 328.28 |
| IUPAC Name | 1-ethyl-2-[3-(2-methoxyethoxy)propyl]-3-(4-pyrrolidin-1-ylbutyl)guanidine |
| SMILES | CCN/C(=N\CCCOCCOC)NCCCCN1CCCC1 |
| InChI | InChI=1S/C17H36N4O2/c1-3-18-17(20-10-8-14-23-16-15-22-2)19-9-4-5-11-21-12-6-7-13-21/h3-16H2,1-2H3,(H2,18,19,20) |
| InChIKey | NGPACIBSXPHAPM-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.50 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|