C11H25N3O2 — CID 110926989
1,3-diethyl-2-[3-(2-methoxyethoxy)propyl]guanidine (PubChem CID 110926989) has the molecular formula C11H25N3O2 and a molecular weight of 231.34 g/mol. Its IUPAC name is 1,3-diethyl-2-[3-(2-methoxyethoxy)propyl]guanidine.
| Compound Name | 1,3-diethyl-2-[3-(2-methoxyethoxy)propyl]guanidine |
|---|---|
| PubChem CID | 110926989 |
| Molecular Formula | C11H25N3O2 |
| Molecular Weight | 231.34 g/mol |
| Exact Mass | 231.19 |
| IUPAC Name | 1,3-diethyl-2-[3-(2-methoxyethoxy)propyl]guanidine |
| SMILES | CCNC(=NCCCOCCOC)NCC |
| InChI | InChI=1S/C11H25N3O2/c1-4-12-11(13-5-2)14-7-6-8-16-10-9-15-3/h4-10H2,1-3H3,(H2,12,13,14) |
| InChIKey | MMAGTKNUMBRORC-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.34 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|