C16H37IN4O2 — CID 111840212
1-ethyl-3-[2-[ethyl(propyl)amino]ethyl]-2-[3-(2-methoxyethoxy)propyl]guanidine;hydroiodide (PubChem CID 111840212) has the molecular formula C16H37IN4O2 and a molecular weight of 444.40 g/mol. Its IUPAC name is 1-ethyl-3-[2-[ethyl(propyl)amino]ethyl]-2-[3-(2-methoxyethoxy)propyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-3-[2-[ethyl(propyl)amino]ethyl]-2-[3-(2-methoxyethoxy)propyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111840212 |
| Molecular Formula | C16H37IN4O2 |
| Molecular Weight | 444.40 g/mol |
| Exact Mass | 444.20 |
| IUPAC Name | 1-ethyl-3-[2-[ethyl(propyl)amino]ethyl]-2-[3-(2-methoxyethoxy)propyl]guanidine;hydroiodide |
| SMILES | CCCN(CC)CCN/C(=N/CCCOCCOC)NCC.I |
| InChI | InChI=1S/C16H36N4O2.HI/c1-5-11-20(7-3)12-10-19-16(17-6-2)18-9-8-13-22-15-14-21-4;/h5-15H2,1-4H3,(H2,17,18,19);1H |
| InChIKey | JJQQGZMLKWAYLK-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.40 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|