C13H17Cl2N5 — CID 136922099
2-[2-[(3,5-dichloro-2-pyridinyl)amino]ethyl]-1-ethyl-3-prop-2-ynylguanidine (PubChem CID 136922099) has the molecular formula C13H17Cl2N5 and a molecular weight of 314.22 g/mol. Its IUPAC name is 2-[2-[(3,5-dichloro-2-pyridinyl)amino]ethyl]-1-ethyl-3-prop-2-ynylguanidine.
| Compound Name | 2-[2-[(3,5-dichloro-2-pyridinyl)amino]ethyl]-1-ethyl-3-prop-2-ynylguanidine |
|---|---|
| PubChem CID | 136922099 |
| Molecular Formula | C13H17Cl2N5 |
| Molecular Weight | 314.22 g/mol |
| Exact Mass | 313.09 |
| IUPAC Name | 2-[2-[(3,5-dichloro-2-pyridinyl)amino]ethyl]-1-ethyl-3-prop-2-ynylguanidine |
| SMILES | C#CCN/C(=N/CCNc1ncc(Cl)cc1Cl)NCC |
| InChI | InChI=1S/C13H17Cl2N5/c1-3-5-18-13(16-4-2)19-7-6-17-12-11(15)8-10(14)9-20-12/h1,8-9H,4-7H2,2H3,(H,17,20)(H2,16,18,19) |
| InChIKey | NJRRNDQPGSVBGK-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 61.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.22 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|