C17H26Cl2IN5O2 — CID 111251962
methyl 1-[N'-[2-[(3,5-dichloro-2-pyridinyl)amino]ethyl]-N-ethylcarbamimidoyl]piperidine-4-carboxylate;hydroiodide (PubChem CID 111251962) has the molecular formula C17H26Cl2IN5O2 and a molecular weight of 530.24 g/mol. Its IUPAC name is methyl 1-[N'-[2-[(3,5-dichloro-2-pyridinyl)amino]ethyl]-N-ethylcarbamimidoyl]piperidine-4-carboxylate;hydroiodide.
| Compound Name | methyl 1-[N'-[2-[(3,5-dichloro-2-pyridinyl)amino]ethyl]-N-ethylcarbamimidoyl]piperidine-4-carboxylate;hydroiodide |
|---|---|
| PubChem CID | 111251962 |
| Molecular Formula | C17H26Cl2IN5O2 |
| Molecular Weight | 530.24 g/mol |
| Exact Mass | 529.05 |
| IUPAC Name | methyl 1-[N'-[2-[(3,5-dichloro-2-pyridinyl)amino]ethyl]-N-ethylcarbamimidoyl]piperidine-4-carboxylate;hydroiodide |
| SMILES | CCN/C(=N\CCNc1ncc(Cl)cc1Cl)N1CCC(C(=O)OC)CC1.I |
| InChI | InChI=1S/C17H25Cl2N5O2.HI/c1-3-20-17(24-8-4-12(5-9-24)16(25)26-2)22-7-6-21-15-14(19)10-13(18)11-23-15;/h10-12H,3-9H2,1-2H3,(H,20,22)(H,21,23);1H |
| InChIKey | LQVQPZICLGNHNY-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 78.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.24 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|