C17H24BrClIN3O2 — CID 111253480
methyl 1-[N'-[(4-bromo-2-chlorophenyl)methyl]-N-ethylcarbamimidoyl]piperidine-4-carboxylate;hydroiodide (PubChem CID 111253480) has the molecular formula C17H24BrClIN3O2 and a molecular weight of 544.66 g/mol. Its IUPAC name is methyl 1-[N'-[(4-bromo-2-chlorophenyl)methyl]-N-ethylcarbamimidoyl]piperidine-4-carboxylate;hydroiodide.
| Compound Name | methyl 1-[N'-[(4-bromo-2-chlorophenyl)methyl]-N-ethylcarbamimidoyl]piperidine-4-carboxylate;hydroiodide |
|---|---|
| PubChem CID | 111253480 |
| Molecular Formula | C17H24BrClIN3O2 |
| Molecular Weight | 544.66 g/mol |
| Exact Mass | 542.98 |
| IUPAC Name | methyl 1-[N'-[(4-bromo-2-chlorophenyl)methyl]-N-ethylcarbamimidoyl]piperidine-4-carboxylate;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(Br)cc1Cl)N1CCC(C(=O)OC)CC1.I |
| InChI | InChI=1S/C17H23BrClN3O2.HI/c1-3-20-17(21-11-13-4-5-14(18)10-15(13)19)22-8-6-12(7-9-22)16(23)24-2;/h4-5,10,12H,3,6-9,11H2,1-2H3,(H,20,21);1H |
| InChIKey | LRRSQSHFQCWTQU-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 53.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.66 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|