C17H25BrClN3O — CID 111959257
N'-[(4-bromo-2-chlorophenyl)methyl]-4-ethoxy-N-ethylpiperidine-1-carboximidamide (PubChem CID 111959257) has the molecular formula C17H25BrClN3O and a molecular weight of 402.76 g/mol. Its IUPAC name is N'-[(4-bromo-2-chlorophenyl)methyl]-4-ethoxy-N-ethylpiperidine-1-carboximidamide.
| Compound Name | N'-[(4-bromo-2-chlorophenyl)methyl]-4-ethoxy-N-ethylpiperidine-1-carboximidamide |
|---|---|
| PubChem CID | 111959257 |
| Molecular Formula | C17H25BrClN3O |
| Molecular Weight | 402.76 g/mol |
| Exact Mass | 401.09 |
| IUPAC Name | N'-[(4-bromo-2-chlorophenyl)methyl]-4-ethoxy-N-ethylpiperidine-1-carboximidamide |
| SMILES | CCN/C(=N\Cc1ccc(Br)cc1Cl)N1CCC(OCC)CC1 |
| InChI | InChI=1S/C17H25BrClN3O/c1-3-20-17(22-9-7-15(8-10-22)23-4-2)21-12-13-5-6-14(18)11-16(13)19/h5-6,11,15H,3-4,7-10,12H2,1-2H3,(H,20,21) |
| InChIKey | BNQBPGWYYPIXNP-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 36.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.76 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|