C23H39IN4O — CID 111960418
4-ethoxy-N-ethyl-N'-[[4-(piperidin-1-ylmethyl)phenyl]methyl]piperidine-1-carboximidamide;hydroiodide (PubChem CID 111960418) has the molecular formula C23H39IN4O and a molecular weight of 514.50 g/mol. Its IUPAC name is 4-ethoxy-N-ethyl-N'-[[4-(piperidin-1-ylmethyl)phenyl]methyl]piperidine-1-carboximidamide;hydroiodide.
| Compound Name | 4-ethoxy-N-ethyl-N'-[[4-(piperidin-1-ylmethyl)phenyl]methyl]piperidine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111960418 |
| Molecular Formula | C23H39IN4O |
| Molecular Weight | 514.50 g/mol |
| Exact Mass | 514.22 |
| IUPAC Name | 4-ethoxy-N-ethyl-N'-[[4-(piperidin-1-ylmethyl)phenyl]methyl]piperidine-1-carboximidamide;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(CN2CCCCC2)cc1)N1CCC(OCC)CC1.I |
| InChI | InChI=1S/C23H38N4O.HI/c1-3-24-23(27-16-12-22(13-17-27)28-4-2)25-18-20-8-10-21(11-9-20)19-26-14-6-5-7-15-26;/h8-11,22H,3-7,12-19H2,1-2H3,(H,24,25);1H |
| InChIKey | PTMFZMPTSZYESN-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 40.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.50 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|