C20H31N3O5 — CID 111255283
methyl 1-[N-ethyl-N'-[(2,4,6-trimethoxyphenyl)methyl]carbamimidoyl]piperidine-4-carboxylate (PubChem CID 111255283) has the molecular formula C20H31N3O5 and a molecular weight of 393.48 g/mol. Its IUPAC name is methyl 1-[N-ethyl-N'-[(2,4,6-trimethoxyphenyl)methyl]carbamimidoyl]piperidine-4-carboxylate.
| Compound Name | methyl 1-[N-ethyl-N'-[(2,4,6-trimethoxyphenyl)methyl]carbamimidoyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 111255283 |
| Molecular Formula | C20H31N3O5 |
| Molecular Weight | 393.48 g/mol |
| Exact Mass | 393.23 |
| IUPAC Name | methyl 1-[N-ethyl-N'-[(2,4,6-trimethoxyphenyl)methyl]carbamimidoyl]piperidine-4-carboxylate |
| SMILES | CCN/C(=N\Cc1c(OC)cc(OC)cc1OC)N1CCC(C(=O)OC)CC1 |
| InChI | InChI=1S/C20H31N3O5/c1-6-21-20(23-9-7-14(8-10-23)19(24)28-5)22-13-16-17(26-3)11-15(25-2)12-18(16)27-4/h11-12,14H,6-10,13H2,1-5H3,(H,21,22) |
| InChIKey | WRVMJLCPJJOCMU-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 81.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.48 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|