C20H31ClIN3O2 — CID 111253692
methyl 1-[N'-[2-(2-chlorophenyl)-2-methylpropyl]-N-ethylcarbamimidoyl]piperidine-4-carboxylate;hydroiodide (PubChem CID 111253692) has the molecular formula C20H31ClIN3O2 and a molecular weight of 507.84 g/mol. Its IUPAC name is methyl 1-[N'-[2-(2-chlorophenyl)-2-methylpropyl]-N-ethylcarbamimidoyl]piperidine-4-carboxylate;hydroiodide.
| Compound Name | methyl 1-[N'-[2-(2-chlorophenyl)-2-methylpropyl]-N-ethylcarbamimidoyl]piperidine-4-carboxylate;hydroiodide |
|---|---|
| PubChem CID | 111253692 |
| Molecular Formula | C20H31ClIN3O2 |
| Molecular Weight | 507.84 g/mol |
| Exact Mass | 507.11 |
| IUPAC Name | methyl 1-[N'-[2-(2-chlorophenyl)-2-methylpropyl]-N-ethylcarbamimidoyl]piperidine-4-carboxylate;hydroiodide |
| SMILES | CCN/C(=N\CC(C)(C)c1ccccc1Cl)N1CCC(C(=O)OC)CC1.I |
| InChI | InChI=1S/C20H30ClN3O2.HI/c1-5-22-19(24-12-10-15(11-13-24)18(25)26-4)23-14-20(2,3)16-8-6-7-9-17(16)21;/h6-9,15H,5,10-14H2,1-4H3,(H,22,23);1H |
| InChIKey | PUDZHMCKOGUCJU-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 53.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.84 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|