C22H36IN3O2 — CID 111254576
methyl 1-[N'-[2-(4-tert-butylphenyl)ethyl]-N-ethylcarbamimidoyl]piperidine-4-carboxylate;hydroiodide (PubChem CID 111254576) has the molecular formula C22H36IN3O2 and a molecular weight of 501.45 g/mol. Its IUPAC name is methyl 1-[N'-[2-(4-tert-butylphenyl)ethyl]-N-ethylcarbamimidoyl]piperidine-4-carboxylate;hydroiodide.
| Compound Name | methyl 1-[N'-[2-(4-tert-butylphenyl)ethyl]-N-ethylcarbamimidoyl]piperidine-4-carboxylate;hydroiodide |
|---|---|
| PubChem CID | 111254576 |
| Molecular Formula | C22H36IN3O2 |
| Molecular Weight | 501.45 g/mol |
| Exact Mass | 501.19 |
| IUPAC Name | methyl 1-[N'-[2-(4-tert-butylphenyl)ethyl]-N-ethylcarbamimidoyl]piperidine-4-carboxylate;hydroiodide |
| SMILES | CCN/C(=N\CCc1ccc(C(C)(C)C)cc1)N1CCC(C(=O)OC)CC1.I |
| InChI | InChI=1S/C22H35N3O2.HI/c1-6-23-21(25-15-12-18(13-16-25)20(26)27-5)24-14-11-17-7-9-19(10-8-17)22(2,3)4;/h7-10,18H,6,11-16H2,1-5H3,(H,23,24);1H |
| InChIKey | ZOQXWTPUSIOVCV-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 53.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.45 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|