C19H30IN3O3 — CID 111253688
methyl 1-[N-ethyl-N'-(2-hydroxy-3-phenylpropyl)carbamimidoyl]piperidine-4-carboxylate;hydroiodide (PubChem CID 111253688) has the molecular formula C19H30IN3O3 and a molecular weight of 475.37 g/mol. Its IUPAC name is methyl 1-[N-ethyl-N'-(2-hydroxy-3-phenylpropyl)carbamimidoyl]piperidine-4-carboxylate;hydroiodide.
| Compound Name | methyl 1-[N-ethyl-N'-(2-hydroxy-3-phenylpropyl)carbamimidoyl]piperidine-4-carboxylate;hydroiodide |
|---|---|
| PubChem CID | 111253688 |
| Molecular Formula | C19H30IN3O3 |
| Molecular Weight | 475.37 g/mol |
| Exact Mass | 475.13 |
| IUPAC Name | methyl 1-[N-ethyl-N'-(2-hydroxy-3-phenylpropyl)carbamimidoyl]piperidine-4-carboxylate;hydroiodide |
| SMILES | CCN/C(=N\CC(O)Cc1ccccc1)N1CCC(C(=O)OC)CC1.I |
| InChI | InChI=1S/C19H29N3O3.HI/c1-3-20-19(22-11-9-16(10-12-22)18(24)25-2)21-14-17(23)13-15-7-5-4-6-8-15;/h4-8,16-17,23H,3,9-14H2,1-2H3,(H,20,21);1H |
| InChIKey | XCVGTIQNWKFCGN-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 74.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.37 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|