C23H37N5O2 — CID 111254809
methyl 1-[N'-[2-(4-benzylpiperazin-1-yl)ethyl]-N-ethylcarbamimidoyl]piperidine-4-carboxylate (PubChem CID 111254809) has the molecular formula C23H37N5O2 and a molecular weight of 415.58 g/mol. Its IUPAC name is methyl 1-[N'-[2-(4-benzylpiperazin-1-yl)ethyl]-N-ethylcarbamimidoyl]piperidine-4-carboxylate.
| Compound Name | methyl 1-[N'-[2-(4-benzylpiperazin-1-yl)ethyl]-N-ethylcarbamimidoyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 111254809 |
| Molecular Formula | C23H37N5O2 |
| Molecular Weight | 415.58 g/mol |
| Exact Mass | 415.29 |
| IUPAC Name | methyl 1-[N'-[2-(4-benzylpiperazin-1-yl)ethyl]-N-ethylcarbamimidoyl]piperidine-4-carboxylate |
| SMILES | CCN/C(=N\CCN1CCN(Cc2ccccc2)CC1)N1CCC(C(=O)OC)CC1 |
| InChI | InChI=1S/C23H37N5O2/c1-3-24-23(28-12-9-21(10-13-28)22(29)30-2)25-11-14-26-15-17-27(18-16-26)19-20-7-5-4-6-8-20/h4-8,21H,3,9-19H2,1-2H3,(H,24,25) |
| InChIKey | YEDAOMFRAZZASZ-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 60.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.58 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|