C24H39N5O2 — CID 111254813
methyl 1-[N-[4-(4-benzylpiperazin-1-yl)butyl]-N'-methylcarbamimidoyl]piperidine-4-carboxylate (PubChem CID 111254813) has the molecular formula C24H39N5O2 and a molecular weight of 429.61 g/mol. Its IUPAC name is methyl 1-[N-[4-(4-benzylpiperazin-1-yl)butyl]-N'-methylcarbamimidoyl]piperidine-4-carboxylate.
| Compound Name | methyl 1-[N-[4-(4-benzylpiperazin-1-yl)butyl]-N'-methylcarbamimidoyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 111254813 |
| Molecular Formula | C24H39N5O2 |
| Molecular Weight | 429.61 g/mol |
| Exact Mass | 429.31 |
| IUPAC Name | methyl 1-[N-[4-(4-benzylpiperazin-1-yl)butyl]-N'-methylcarbamimidoyl]piperidine-4-carboxylate |
| SMILES | C/N=C(\NCCCCN1CCN(Cc2ccccc2)CC1)N1CCC(C(=O)OC)CC1 |
| InChI | InChI=1S/C24H39N5O2/c1-25-24(29-14-10-22(11-15-29)23(30)31-2)26-12-6-7-13-27-16-18-28(19-17-27)20-21-8-4-3-5-9-21/h3-5,8-9,22H,6-7,10-20H2,1-2H3,(H,25,26) |
| InChIKey | XXRRFOQBGZAOJL-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 60.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.61 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|