C21H36IN5 — CID 110959674
4-benzyl-N'-methyl-N-(4-pyrrolidin-1-ylbutyl)piperazine-1-carboximidamide;hydroiodide (PubChem CID 110959674) has the molecular formula C21H36IN5 and a molecular weight of 485.46 g/mol. Its IUPAC name is 4-benzyl-N'-methyl-N-(4-pyrrolidin-1-ylbutyl)piperazine-1-carboximidamide;hydroiodide.
| Compound Name | 4-benzyl-N'-methyl-N-(4-pyrrolidin-1-ylbutyl)piperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 110959674 |
| Molecular Formula | C21H36IN5 |
| Molecular Weight | 485.46 g/mol |
| Exact Mass | 485.20 |
| IUPAC Name | 4-benzyl-N'-methyl-N-(4-pyrrolidin-1-ylbutyl)piperazine-1-carboximidamide;hydroiodide |
| SMILES | C/N=C(\NCCCCN1CCCC1)N1CCN(Cc2ccccc2)CC1.I |
| InChI | InChI=1S/C21H35N5.HI/c1-22-21(23-11-5-6-12-24-13-7-8-14-24)26-17-15-25(16-18-26)19-20-9-3-2-4-10-20;/h2-4,9-10H,5-8,11-19H2,1H3,(H,22,23);1H |
| InChIKey | NUHLGXDGJCMLGS-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 34.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.46 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|