C23H39N5O — CID 111959165
N-[3-(4-benzylpiperazin-1-yl)propyl]-4-ethoxy-N'-methylpiperidine-1-carboximidamide (PubChem CID 111959165) has the molecular formula C23H39N5O and a molecular weight of 401.60 g/mol. Its IUPAC name is N-[3-(4-benzylpiperazin-1-yl)propyl]-4-ethoxy-N'-methylpiperidine-1-carboximidamide.
| Compound Name | N-[3-(4-benzylpiperazin-1-yl)propyl]-4-ethoxy-N'-methylpiperidine-1-carboximidamide |
|---|---|
| PubChem CID | 111959165 |
| Molecular Formula | C23H39N5O |
| Molecular Weight | 401.60 g/mol |
| Exact Mass | 401.32 |
| IUPAC Name | N-[3-(4-benzylpiperazin-1-yl)propyl]-4-ethoxy-N'-methylpiperidine-1-carboximidamide |
| SMILES | CCOC1CCN(/C(=N/C)NCCCN2CCN(Cc3ccccc3)CC2)CC1 |
| InChI | InChI=1S/C23H39N5O/c1-3-29-22-10-14-28(15-11-22)23(24-2)25-12-7-13-26-16-18-27(19-17-26)20-21-8-5-4-6-9-21/h4-6,8-9,22H,3,7,10-20H2,1-2H3,(H,24,25) |
| InChIKey | DUNQKJZXEDDJGR-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 43.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.60 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|