C20H30N4O — CID 111959403
4-ethoxy-N-(3-indol-1-ylpropyl)-N'-methylpiperidine-1-carboximidamide (PubChem CID 111959403) has the molecular formula C20H30N4O and a molecular weight of 342.49 g/mol. Its IUPAC name is 4-ethoxy-N-(3-indol-1-ylpropyl)-N'-methylpiperidine-1-carboximidamide.
| Compound Name | 4-ethoxy-N-(3-indol-1-ylpropyl)-N'-methylpiperidine-1-carboximidamide |
|---|---|
| PubChem CID | 111959403 |
| Molecular Formula | C20H30N4O |
| Molecular Weight | 342.49 g/mol |
| Exact Mass | 342.24 |
| IUPAC Name | 4-ethoxy-N-(3-indol-1-ylpropyl)-N'-methylpiperidine-1-carboximidamide |
| SMILES | CCOC1CCN(/C(=N\C)NCCCn2ccc3ccccc32)CC1 |
| InChI | InChI=1S/C20H30N4O/c1-3-25-18-10-15-24(16-11-18)20(21-2)22-12-6-13-23-14-9-17-7-4-5-8-19(17)23/h4-5,7-9,14,18H,3,6,10-13,15-16H2,1-2H3,(H,21,22) |
| InChIKey | QFXARMZTTPRDPL-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 41.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.49 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|