C17H24N4 — CID 110933615
N-(3-indol-1-ylpropyl)-N'-methylpyrrolidine-1-carboximidamide (PubChem CID 110933615) has the molecular formula C17H24N4 and a molecular weight of 284.41 g/mol. Its IUPAC name is N-(3-indol-1-ylpropyl)-N'-methylpyrrolidine-1-carboximidamide.
| Compound Name | N-(3-indol-1-ylpropyl)-N'-methylpyrrolidine-1-carboximidamide |
|---|---|
| PubChem CID | 110933615 |
| Molecular Formula | C17H24N4 |
| Molecular Weight | 284.41 g/mol |
| Exact Mass | 284.20 |
| IUPAC Name | N-(3-indol-1-ylpropyl)-N'-methylpyrrolidine-1-carboximidamide |
| SMILES | C/N=C(/NCCCn1ccc2ccccc21)N1CCCC1 |
| InChI | InChI=1S/C17H24N4/c1-18-17(21-11-4-5-12-21)19-10-6-13-20-14-9-15-7-2-3-8-16(15)20/h2-3,7-9,14H,4-6,10-13H2,1H3,(H,18,19) |
| InChIKey | OKCLHPUAAIMPCW-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 32.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.41 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|