C21H35N5 — CID 111341527
1-[4-(diethylamino)butyl]-3-(3-indol-1-ylpropyl)-2-methylguanidine (PubChem CID 111341527) has the molecular formula C21H35N5 and a molecular weight of 357.55 g/mol. Its IUPAC name is 1-[4-(diethylamino)butyl]-3-(3-indol-1-ylpropyl)-2-methylguanidine.
| Compound Name | 1-[4-(diethylamino)butyl]-3-(3-indol-1-ylpropyl)-2-methylguanidine |
|---|---|
| PubChem CID | 111341527 |
| Molecular Formula | C21H35N5 |
| Molecular Weight | 357.55 g/mol |
| Exact Mass | 357.29 |
| IUPAC Name | 1-[4-(diethylamino)butyl]-3-(3-indol-1-ylpropyl)-2-methylguanidine |
| SMILES | CCN(CC)CCCCN/C(=N\C)NCCCn1ccc2ccccc21 |
| InChI | InChI=1S/C21H35N5/c1-4-25(5-2)16-9-8-14-23-21(22-3)24-15-10-17-26-18-13-19-11-6-7-12-20(19)26/h6-7,11-13,18H,4-5,8-10,14-17H2,1-3H3,(H2,22,23,24) |
| InChIKey | KYTFHXHRGFQUSS-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 44.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.55 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|