C19H27IN6 — CID 111341640
1-(3-indol-1-ylpropyl)-2-methyl-3-(3-pyrazol-1-ylpropyl)guanidine;hydroiodide (PubChem CID 111341640) has the molecular formula C19H27IN6 and a molecular weight of 466.37 g/mol. Its IUPAC name is 1-(3-indol-1-ylpropyl)-2-methyl-3-(3-pyrazol-1-ylpropyl)guanidine;hydroiodide.
| Compound Name | 1-(3-indol-1-ylpropyl)-2-methyl-3-(3-pyrazol-1-ylpropyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111341640 |
| Molecular Formula | C19H27IN6 |
| Molecular Weight | 466.37 g/mol |
| Exact Mass | 466.13 |
| IUPAC Name | 1-(3-indol-1-ylpropyl)-2-methyl-3-(3-pyrazol-1-ylpropyl)guanidine;hydroiodide |
| SMILES | C/N=C(\NCCCn1cccn1)NCCCn1ccc2ccccc21.I |
| InChI | InChI=1S/C19H26N6.HI/c1-20-19(22-11-5-14-25-15-6-12-23-25)21-10-4-13-24-16-9-17-7-2-3-8-18(17)24;/h2-3,6-9,12,15-16H,4-5,10-11,13-14H2,1H3,(H2,20,21,22);1H |
| InChIKey | QQEULPWSCSLGQK-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 59.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.37 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|