C19H28F3N5 — CID 111341693
1-(3-indol-1-ylpropyl)-2-methyl-3-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]guanidine (PubChem CID 111341693) has the molecular formula C19H28F3N5 and a molecular weight of 383.46 g/mol. Its IUPAC name is 1-(3-indol-1-ylpropyl)-2-methyl-3-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]guanidine.
| Compound Name | 1-(3-indol-1-ylpropyl)-2-methyl-3-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]guanidine |
|---|---|
| PubChem CID | 111341693 |
| Molecular Formula | C19H28F3N5 |
| Molecular Weight | 383.46 g/mol |
| Exact Mass | 383.23 |
| IUPAC Name | 1-(3-indol-1-ylpropyl)-2-methyl-3-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]guanidine |
| SMILES | C/N=C(\NCCCN(C)CC(F)(F)F)NCCCn1ccc2ccccc21 |
| InChI | InChI=1S/C19H28F3N5/c1-23-18(24-10-5-12-26(2)15-19(20,21)22)25-11-6-13-27-14-9-16-7-3-4-8-17(16)27/h3-4,7-9,14H,5-6,10-13,15H2,1-2H3,(H2,23,24,25) |
| InChIKey | DRQSYYXMBORXJS-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 44.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.46 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|