C20H24F3N7 — CID 111775308
1-(3-indol-1-ylpropyl)-2-methyl-3-[2-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]ethyl]guanidine (PubChem CID 111775308) has the molecular formula C20H24F3N7 and a molecular weight of 419.46 g/mol. Its IUPAC name is 1-(3-indol-1-ylpropyl)-2-methyl-3-[2-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]ethyl]guanidine.
| Compound Name | 1-(3-indol-1-ylpropyl)-2-methyl-3-[2-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]ethyl]guanidine |
|---|---|
| PubChem CID | 111775308 |
| Molecular Formula | C20H24F3N7 |
| Molecular Weight | 419.46 g/mol |
| Exact Mass | 419.20 |
| IUPAC Name | 1-(3-indol-1-ylpropyl)-2-methyl-3-[2-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]ethyl]guanidine |
| SMILES | C/N=C(/NCCCn1ccc2ccccc21)NCCNc1nccc(C(F)(F)F)n1 |
| InChI | InChI=1S/C20H24F3N7/c1-24-18(25-9-4-13-30-14-8-15-5-2-3-6-16(15)30)27-11-12-28-19-26-10-7-17(29-19)20(21,22)23/h2-3,5-8,10,14H,4,9,11-13H2,1H3,(H2,24,25,27)(H,26,28,29) |
| InChIKey | LEPJTRBFTPZFJE-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 79.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.46 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|