C18H30F3N7 — CID 111775066
1-[3-(azepan-1-yl)propyl]-2-methyl-3-[2-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]ethyl]guanidine (PubChem CID 111775066) has the molecular formula C18H30F3N7 and a molecular weight of 401.48 g/mol. Its IUPAC name is 1-[3-(azepan-1-yl)propyl]-2-methyl-3-[2-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]ethyl]guanidine.
| Compound Name | 1-[3-(azepan-1-yl)propyl]-2-methyl-3-[2-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]ethyl]guanidine |
|---|---|
| PubChem CID | 111775066 |
| Molecular Formula | C18H30F3N7 |
| Molecular Weight | 401.48 g/mol |
| Exact Mass | 401.25 |
| IUPAC Name | 1-[3-(azepan-1-yl)propyl]-2-methyl-3-[2-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]ethyl]guanidine |
| SMILES | C/N=C(/NCCCN1CCCCCC1)NCCNc1nccc(C(F)(F)F)n1 |
| InChI | InChI=1S/C18H30F3N7/c1-22-16(23-8-6-14-28-12-4-2-3-5-13-28)25-10-11-26-17-24-9-7-15(27-17)18(19,20)21/h7,9H,2-6,8,10-14H2,1H3,(H2,22,23,25)(H,24,26,27) |
| InChIKey | LUGYXDIDLBKBHN-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 77.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.48 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|