C16H19F4IN6 — CID 111773789
1-[(4-fluorophenyl)methyl]-2-methyl-3-[2-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]ethyl]guanidine;hydroiodide (PubChem CID 111773789) has the molecular formula C16H19F4IN6 and a molecular weight of 498.27 g/mol. Its IUPAC name is 1-[(4-fluorophenyl)methyl]-2-methyl-3-[2-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]ethyl]guanidine;hydroiodide.
| Compound Name | 1-[(4-fluorophenyl)methyl]-2-methyl-3-[2-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111773789 |
| Molecular Formula | C16H19F4IN6 |
| Molecular Weight | 498.27 g/mol |
| Exact Mass | 498.07 |
| IUPAC Name | 1-[(4-fluorophenyl)methyl]-2-methyl-3-[2-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]ethyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCCNc1nccc(C(F)(F)F)n1)NCc1ccc(F)cc1.I |
| InChI | InChI=1S/C16H18F4N6.HI/c1-21-14(25-10-11-2-4-12(17)5-3-11)23-8-9-24-15-22-7-6-13(26-15)16(18,19)20;/h2-7H,8-10H2,1H3,(H2,21,23,25)(H,22,24,26);1H |
| InChIKey | JGNUBKBJPULJAY-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 74.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.27 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|