C15H26F3IN6 — CID 111772123
1-ethyl-2-pentyl-3-[2-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]ethyl]guanidine;hydroiodide (PubChem CID 111772123) has the molecular formula C15H26F3IN6 and a molecular weight of 474.31 g/mol. Its IUPAC name is 1-ethyl-2-pentyl-3-[2-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]ethyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-2-pentyl-3-[2-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111772123 |
| Molecular Formula | C15H26F3IN6 |
| Molecular Weight | 474.31 g/mol |
| Exact Mass | 474.12 |
| IUPAC Name | 1-ethyl-2-pentyl-3-[2-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]ethyl]guanidine;hydroiodide |
| SMILES | CCCCC/N=C(\NCC)NCCNc1nccc(C(F)(F)F)n1.I |
| InChI | InChI=1S/C15H25F3N6.HI/c1-3-5-6-8-20-13(19-4-2)22-10-11-23-14-21-9-7-12(24-14)15(16,17)18;/h7,9H,3-6,8,10-11H2,1-2H3,(H2,19,20,22)(H,21,23,24);1H |
| InChIKey | JDEUFODKZDQKDM-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 74.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.31 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|