C14H23F3N6O — CID 111773602
1-(3-ethoxypropyl)-2-methyl-3-[2-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]ethyl]guanidine (PubChem CID 111773602) has the molecular formula C14H23F3N6O and a molecular weight of 348.37 g/mol. Its IUPAC name is 1-(3-ethoxypropyl)-2-methyl-3-[2-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]ethyl]guanidine.
| Compound Name | 1-(3-ethoxypropyl)-2-methyl-3-[2-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]ethyl]guanidine |
|---|---|
| PubChem CID | 111773602 |
| Molecular Formula | C14H23F3N6O |
| Molecular Weight | 348.37 g/mol |
| Exact Mass | 348.19 |
| IUPAC Name | 1-(3-ethoxypropyl)-2-methyl-3-[2-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]ethyl]guanidine |
| SMILES | CCOCCCN/C(=N\C)NCCNc1nccc(C(F)(F)F)n1 |
| InChI | InChI=1S/C14H23F3N6O/c1-3-24-10-4-6-19-12(18-2)21-8-9-22-13-20-7-5-11(23-13)14(15,16)17/h5,7H,3-4,6,8-10H2,1-2H3,(H2,18,19,21)(H,20,22,23) |
| InChIKey | MAYBIXQFNZZGGN-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 83.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.37 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|