C17H27F3IN7O2 — CID 111775173
ethyl 4-[[N'-methyl-N-[2-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]ethyl]carbamimidoyl]amino]piperidine-1-carboxylate;hydroiodide (PubChem CID 111775173) has the molecular formula C17H27F3IN7O2 and a molecular weight of 545.35 g/mol. Its IUPAC name is ethyl 4-[[N'-methyl-N-[2-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]ethyl]carbamimidoyl]amino]piperidine-1-carboxylate;hydroiodide.
| Compound Name | ethyl 4-[[N'-methyl-N-[2-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]ethyl]carbamimidoyl]amino]piperidine-1-carboxylate;hydroiodide |
|---|---|
| PubChem CID | 111775173 |
| Molecular Formula | C17H27F3IN7O2 |
| Molecular Weight | 545.35 g/mol |
| Exact Mass | 545.12 |
| IUPAC Name | ethyl 4-[[N'-methyl-N-[2-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]ethyl]carbamimidoyl]amino]piperidine-1-carboxylate;hydroiodide |
| SMILES | CCOC(=O)N1CCC(N/C(=N/C)NCCNc2nccc(C(F)(F)F)n2)CC1.I |
| InChI | InChI=1S/C17H26F3N7O2.HI/c1-3-29-16(28)27-10-5-12(6-11-27)25-14(21-2)23-8-9-24-15-22-7-4-13(26-15)17(18,19)20;/h4,7,12H,3,5-6,8-11H2,1-2H3,(H2,21,23,25)(H,22,24,26);1H |
| InChIKey | PZBCZQGHSLJMCV-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 103.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.35 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|