C19H24ClF3IN7 — CID 109463695
1-[1-(3-chlorophenyl)pyrrolidin-3-yl]-2-methyl-3-[2-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]ethyl]guanidine;hydroiodide (PubChem CID 109463695) has the molecular formula C19H24ClF3IN7 and a molecular weight of 569.80 g/mol. Its IUPAC name is 1-[1-(3-chlorophenyl)pyrrolidin-3-yl]-2-methyl-3-[2-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]ethyl]guanidine;hydroiodide.
| Compound Name | 1-[1-(3-chlorophenyl)pyrrolidin-3-yl]-2-methyl-3-[2-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 109463695 |
| Molecular Formula | C19H24ClF3IN7 |
| Molecular Weight | 569.80 g/mol |
| Exact Mass | 569.08 |
| IUPAC Name | 1-[1-(3-chlorophenyl)pyrrolidin-3-yl]-2-methyl-3-[2-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]ethyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCCNc1nccc(C(F)(F)F)n1)NC1CCN(c2cccc(Cl)c2)C1.I |
| InChI | InChI=1S/C19H23ClF3N7.HI/c1-24-17(26-8-9-27-18-25-7-5-16(29-18)19(21,22)23)28-14-6-10-30(12-14)15-4-2-3-13(20)11-15;/h2-5,7,11,14H,6,8-10,12H2,1H3,(H2,24,26,28)(H,25,27,29);1H |
| InChIKey | GLDOPILYXSCKEU-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 77.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.80 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|