C18H26ClIN6 — CID 109463105
1-[1-(3-chlorophenyl)pyrrolidin-3-yl]-2-methyl-3-(3-pyrazol-1-ylpropyl)guanidine;hydroiodide (PubChem CID 109463105) has the molecular formula C18H26ClIN6 and a molecular weight of 488.81 g/mol. Its IUPAC name is 1-[1-(3-chlorophenyl)pyrrolidin-3-yl]-2-methyl-3-(3-pyrazol-1-ylpropyl)guanidine;hydroiodide.
| Compound Name | 1-[1-(3-chlorophenyl)pyrrolidin-3-yl]-2-methyl-3-(3-pyrazol-1-ylpropyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 109463105 |
| Molecular Formula | C18H26ClIN6 |
| Molecular Weight | 488.81 g/mol |
| Exact Mass | 488.10 |
| IUPAC Name | 1-[1-(3-chlorophenyl)pyrrolidin-3-yl]-2-methyl-3-(3-pyrazol-1-ylpropyl)guanidine;hydroiodide |
| SMILES | C/N=C(\NCCCn1cccn1)NC1CCN(c2cccc(Cl)c2)C1.I |
| InChI | InChI=1S/C18H25ClN6.HI/c1-20-18(21-8-3-10-25-11-4-9-22-25)23-16-7-12-24(14-16)17-6-2-5-15(19)13-17;/h2,4-6,9,11,13,16H,3,7-8,10,12,14H2,1H3,(H2,20,21,23);1H |
| InChIKey | AEKJBUGWKZKBCW-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 57.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.81 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|