C20H29ClIN5O — CID 109462811
1-[1-(3-chlorophenyl)pyrrolidin-3-yl]-3-[3-(3,5-dimethyl-1,2-oxazol-4-yl)propyl]-2-methylguanidine;hydroiodide (PubChem CID 109462811) has the molecular formula C20H29ClIN5O and a molecular weight of 517.84 g/mol. Its IUPAC name is 1-[1-(3-chlorophenyl)pyrrolidin-3-yl]-3-[3-(3,5-dimethyl-1,2-oxazol-4-yl)propyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-[1-(3-chlorophenyl)pyrrolidin-3-yl]-3-[3-(3,5-dimethyl-1,2-oxazol-4-yl)propyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 109462811 |
| Molecular Formula | C20H29ClIN5O |
| Molecular Weight | 517.84 g/mol |
| Exact Mass | 517.11 |
| IUPAC Name | 1-[1-(3-chlorophenyl)pyrrolidin-3-yl]-3-[3-(3,5-dimethyl-1,2-oxazol-4-yl)propyl]-2-methylguanidine;hydroiodide |
| SMILES | C/N=C(\NCCCc1c(C)noc1C)NC1CCN(c2cccc(Cl)c2)C1.I |
| InChI | InChI=1S/C20H28ClN5O.HI/c1-14-19(15(2)27-25-14)8-5-10-23-20(22-3)24-17-9-11-26(13-17)18-7-4-6-16(21)12-18;/h4,6-7,12,17H,5,8-11,13H2,1-3H3,(H2,22,23,24);1H |
| InChIKey | VJPIHCGJOWTFCM-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 65.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.84 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|