C23H27ClN6 — CID 109463710
1-[1-(3-chlorophenyl)pyrrolidin-3-yl]-2-methyl-3-[[2-(pyrazol-1-ylmethyl)phenyl]methyl]guanidine (PubChem CID 109463710) has the molecular formula C23H27ClN6 and a molecular weight of 422.96 g/mol. Its IUPAC name is 1-[1-(3-chlorophenyl)pyrrolidin-3-yl]-2-methyl-3-[[2-(pyrazol-1-ylmethyl)phenyl]methyl]guanidine.
| Compound Name | 1-[1-(3-chlorophenyl)pyrrolidin-3-yl]-2-methyl-3-[[2-(pyrazol-1-ylmethyl)phenyl]methyl]guanidine |
|---|---|
| PubChem CID | 109463710 |
| Molecular Formula | C23H27ClN6 |
| Molecular Weight | 422.96 g/mol |
| Exact Mass | 422.20 |
| IUPAC Name | 1-[1-(3-chlorophenyl)pyrrolidin-3-yl]-2-methyl-3-[[2-(pyrazol-1-ylmethyl)phenyl]methyl]guanidine |
| SMILES | C/N=C(\NCc1ccccc1Cn1cccn1)NC1CCN(c2cccc(Cl)c2)C1 |
| InChI | InChI=1S/C23H27ClN6/c1-25-23(28-21-10-13-29(17-21)22-9-4-8-20(24)14-22)26-15-18-6-2-3-7-19(18)16-30-12-5-11-27-30/h2-9,11-12,14,21H,10,13,15-17H2,1H3,(H2,25,26,28) |
| InChIKey | MPQGJRSZXNNQPJ-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 57.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.96 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|