C23H28ClIN6 — CID 109462831
1-[(1-benzylimidazol-2-yl)methyl]-3-[1-(3-chlorophenyl)pyrrolidin-3-yl]-2-methylguanidine;hydroiodide (PubChem CID 109462831) has the molecular formula C23H28ClIN6 and a molecular weight of 550.88 g/mol. Its IUPAC name is 1-[(1-benzylimidazol-2-yl)methyl]-3-[1-(3-chlorophenyl)pyrrolidin-3-yl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-[(1-benzylimidazol-2-yl)methyl]-3-[1-(3-chlorophenyl)pyrrolidin-3-yl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 109462831 |
| Molecular Formula | C23H28ClIN6 |
| Molecular Weight | 550.88 g/mol |
| Exact Mass | 550.11 |
| IUPAC Name | 1-[(1-benzylimidazol-2-yl)methyl]-3-[1-(3-chlorophenyl)pyrrolidin-3-yl]-2-methylguanidine;hydroiodide |
| SMILES | C/N=C(\NCc1nccn1Cc1ccccc1)NC1CCN(c2cccc(Cl)c2)C1.I |
| InChI | InChI=1S/C23H27ClN6.HI/c1-25-23(28-20-10-12-29(17-20)21-9-5-8-19(24)14-21)27-15-22-26-11-13-30(22)16-18-6-3-2-4-7-18;/h2-9,11,13-14,20H,10,12,15-17H2,1H3,(H2,25,27,28);1H |
| InChIKey | WJNYAKJELAWHJX-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 57.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.88 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|