C22H27ClIN7 — CID 109464089
1-[1-(3-chlorophenyl)pyrrolidin-3-yl]-2-methyl-3-[[6-(2-methylimidazol-1-yl)-3-pyridinyl]methyl]guanidine;hydroiodide (PubChem CID 109464089) has the molecular formula C22H27ClIN7 and a molecular weight of 551.86 g/mol. Its IUPAC name is 1-[1-(3-chlorophenyl)pyrrolidin-3-yl]-2-methyl-3-[[6-(2-methylimidazol-1-yl)-3-pyridinyl]methyl]guanidine;hydroiodide.
| Compound Name | 1-[1-(3-chlorophenyl)pyrrolidin-3-yl]-2-methyl-3-[[6-(2-methylimidazol-1-yl)-3-pyridinyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 109464089 |
| Molecular Formula | C22H27ClIN7 |
| Molecular Weight | 551.86 g/mol |
| Exact Mass | 551.11 |
| IUPAC Name | 1-[1-(3-chlorophenyl)pyrrolidin-3-yl]-2-methyl-3-[[6-(2-methylimidazol-1-yl)-3-pyridinyl]methyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCc1ccc(-n2ccnc2C)nc1)NC1CCN(c2cccc(Cl)c2)C1.I |
| InChI | InChI=1S/C22H26ClN7.HI/c1-16-25-9-11-30(16)21-7-6-17(13-26-21)14-27-22(24-2)28-19-8-10-29(15-19)20-5-3-4-18(23)12-20;/h3-7,9,11-13,19H,8,10,14-15H2,1-2H3,(H2,24,27,28);1H |
| InChIKey | RQVSVJPXZFPVLT-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 70.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.86 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|