C22H30N6 — CID 111909613
2-methyl-1-(1-phenylpyrrolidin-3-yl)-3-[(6-pyrrolidin-1-yl-3-pyridinyl)methyl]guanidine (PubChem CID 111909613) has the molecular formula C22H30N6 and a molecular weight of 378.52 g/mol. Its IUPAC name is 2-methyl-1-(1-phenylpyrrolidin-3-yl)-3-[(6-pyrrolidin-1-yl-3-pyridinyl)methyl]guanidine.
| Compound Name | 2-methyl-1-(1-phenylpyrrolidin-3-yl)-3-[(6-pyrrolidin-1-yl-3-pyridinyl)methyl]guanidine |
|---|---|
| PubChem CID | 111909613 |
| Molecular Formula | C22H30N6 |
| Molecular Weight | 378.52 g/mol |
| Exact Mass | 378.25 |
| IUPAC Name | 2-methyl-1-(1-phenylpyrrolidin-3-yl)-3-[(6-pyrrolidin-1-yl-3-pyridinyl)methyl]guanidine |
| SMILES | C/N=C(\NCc1ccc(N2CCCC2)nc1)NC1CCN(c2ccccc2)C1 |
| InChI | InChI=1S/C22H30N6/c1-23-22(26-19-11-14-28(17-19)20-7-3-2-4-8-20)25-16-18-9-10-21(24-15-18)27-12-5-6-13-27/h2-4,7-10,15,19H,5-6,11-14,16-17H2,1H3,(H2,23,25,26) |
| InChIKey | BJTZVAVYXBPYPU-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 55.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.52 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|