C24H35IN6 — CID 111924358
2-methyl-1-[1-(4-methylphenyl)pyrrolidin-3-yl]-3-[(2-piperidin-1-yl-4-pyridinyl)methyl]guanidine;hydroiodide (PubChem CID 111924358) has the molecular formula C24H35IN6 and a molecular weight of 534.49 g/mol. Its IUPAC name is 2-methyl-1-[1-(4-methylphenyl)pyrrolidin-3-yl]-3-[(2-piperidin-1-yl-4-pyridinyl)methyl]guanidine;hydroiodide.
| Compound Name | 2-methyl-1-[1-(4-methylphenyl)pyrrolidin-3-yl]-3-[(2-piperidin-1-yl-4-pyridinyl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111924358 |
| Molecular Formula | C24H35IN6 |
| Molecular Weight | 534.49 g/mol |
| Exact Mass | 534.20 |
| IUPAC Name | 2-methyl-1-[1-(4-methylphenyl)pyrrolidin-3-yl]-3-[(2-piperidin-1-yl-4-pyridinyl)methyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCc1ccnc(N2CCCCC2)c1)NC1CCN(c2ccc(C)cc2)C1.I |
| InChI | InChI=1S/C24H34N6.HI/c1-19-6-8-22(9-7-19)30-15-11-21(18-30)28-24(25-2)27-17-20-10-12-26-23(16-20)29-13-4-3-5-14-29;/h6-10,12,16,21H,3-5,11,13-15,17-18H2,1-2H3,(H2,25,27,28);1H |
| InChIKey | KASJONCTGJZFND-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 55.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.49 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|