C23H31FN6 — CID 110990749
1-cyclopentyl-3-[[2-[4-(4-fluorophenyl)piperazin-1-yl]-4-pyridinyl]methyl]-2-methylguanidine (PubChem CID 110990749) has the molecular formula C23H31FN6 and a molecular weight of 410.54 g/mol. Its IUPAC name is 1-cyclopentyl-3-[[2-[4-(4-fluorophenyl)piperazin-1-yl]-4-pyridinyl]methyl]-2-methylguanidine.
| Compound Name | 1-cyclopentyl-3-[[2-[4-(4-fluorophenyl)piperazin-1-yl]-4-pyridinyl]methyl]-2-methylguanidine |
|---|---|
| PubChem CID | 110990749 |
| Molecular Formula | C23H31FN6 |
| Molecular Weight | 410.54 g/mol |
| Exact Mass | 410.26 |
| IUPAC Name | 1-cyclopentyl-3-[[2-[4-(4-fluorophenyl)piperazin-1-yl]-4-pyridinyl]methyl]-2-methylguanidine |
| SMILES | C/N=C(\NCc1ccnc(N2CCN(c3ccc(F)cc3)CC2)c1)NC1CCCC1 |
| InChI | InChI=1S/C23H31FN6/c1-25-23(28-20-4-2-3-5-20)27-17-18-10-11-26-22(16-18)30-14-12-29(13-15-30)21-8-6-19(24)7-9-21/h6-11,16,20H,2-5,12-15,17H2,1H3,(H2,25,27,28) |
| InChIKey | YNLXSUCSOUBULJ-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 55.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.54 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|