C23H33FN6S — CID 111611596
1-[[2-[4-(4-fluorophenyl)piperazin-1-yl]-4-pyridinyl]methyl]-2-methyl-3-(2-methyl-2-methylsulfanylpropyl)guanidine (PubChem CID 111611596) has the molecular formula C23H33FN6S and a molecular weight of 444.62 g/mol. Its IUPAC name is 1-[[2-[4-(4-fluorophenyl)piperazin-1-yl]-4-pyridinyl]methyl]-2-methyl-3-(2-methyl-2-methylsulfanylpropyl)guanidine.
| Compound Name | 1-[[2-[4-(4-fluorophenyl)piperazin-1-yl]-4-pyridinyl]methyl]-2-methyl-3-(2-methyl-2-methylsulfanylpropyl)guanidine |
|---|---|
| PubChem CID | 111611596 |
| Molecular Formula | C23H33FN6S |
| Molecular Weight | 444.62 g/mol |
| Exact Mass | 444.25 |
| IUPAC Name | 1-[[2-[4-(4-fluorophenyl)piperazin-1-yl]-4-pyridinyl]methyl]-2-methyl-3-(2-methyl-2-methylsulfanylpropyl)guanidine |
| SMILES | C/N=C(/NCc1ccnc(N2CCN(c3ccc(F)cc3)CC2)c1)NCC(C)(C)SC |
| InChI | InChI=1S/C23H33FN6S/c1-23(2,31-4)17-28-22(25-3)27-16-18-9-10-26-21(15-18)30-13-11-29(12-14-30)20-7-5-19(24)6-8-20/h5-10,15H,11-14,16-17H2,1-4H3,(H2,25,27,28) |
| InChIKey | WXJKMLJZZPXYPT-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 55.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.62 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|