C23H34FIN6 — CID 111129280
1-[[2-[4-(4-fluorophenyl)piperazin-1-yl]-4-pyridinyl]methyl]-2-methyl-3-pentylguanidine;hydroiodide (PubChem CID 111129280) has the molecular formula C23H34FIN6 and a molecular weight of 540.47 g/mol. Its IUPAC name is 1-[[2-[4-(4-fluorophenyl)piperazin-1-yl]-4-pyridinyl]methyl]-2-methyl-3-pentylguanidine;hydroiodide.
| Compound Name | 1-[[2-[4-(4-fluorophenyl)piperazin-1-yl]-4-pyridinyl]methyl]-2-methyl-3-pentylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111129280 |
| Molecular Formula | C23H34FIN6 |
| Molecular Weight | 540.47 g/mol |
| Exact Mass | 540.19 |
| IUPAC Name | 1-[[2-[4-(4-fluorophenyl)piperazin-1-yl]-4-pyridinyl]methyl]-2-methyl-3-pentylguanidine;hydroiodide |
| SMILES | CCCCCN/C(=N\C)NCc1ccnc(N2CCN(c3ccc(F)cc3)CC2)c1.I |
| InChI | InChI=1S/C23H33FN6.HI/c1-3-4-5-11-27-23(25-2)28-18-19-10-12-26-22(17-19)30-15-13-29(14-16-30)21-8-6-20(24)7-9-21;/h6-10,12,17H,3-5,11,13-16,18H2,1-2H3,(H2,25,27,28);1H |
| InChIKey | KJHNYGLMSXUXOP-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 55.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.47 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|