C21H38IN7 — CID 111016766
2-methyl-1-[[2-(4-methylpiperazin-1-yl)-4-pyridinyl]methyl]-3-(1-propylpiperidin-4-yl)guanidine;hydroiodide (PubChem CID 111016766) has the molecular formula C21H38IN7 and a molecular weight of 515.49 g/mol. Its IUPAC name is 2-methyl-1-[[2-(4-methylpiperazin-1-yl)-4-pyridinyl]methyl]-3-(1-propylpiperidin-4-yl)guanidine;hydroiodide.
| Compound Name | 2-methyl-1-[[2-(4-methylpiperazin-1-yl)-4-pyridinyl]methyl]-3-(1-propylpiperidin-4-yl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111016766 |
| Molecular Formula | C21H38IN7 |
| Molecular Weight | 515.49 g/mol |
| Exact Mass | 515.22 |
| IUPAC Name | 2-methyl-1-[[2-(4-methylpiperazin-1-yl)-4-pyridinyl]methyl]-3-(1-propylpiperidin-4-yl)guanidine;hydroiodide |
| SMILES | CCCN1CCC(N/C(=N/C)NCc2ccnc(N3CCN(C)CC3)c2)CC1.I |
| InChI | InChI=1S/C21H37N7.HI/c1-4-9-27-10-6-19(7-11-27)25-21(22-2)24-17-18-5-8-23-20(16-18)28-14-12-26(3)13-15-28;/h5,8,16,19H,4,6-7,9-15,17H2,1-3H3,(H2,22,24,25);1H |
| InChIKey | XORINDQTENLDPT-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 59.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.49 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|