C18H30N6O2S — CID 111140989
1-(1,1-dioxothiolan-3-yl)-3-[[2-(4-ethylpiperazin-1-yl)-4-pyridinyl]methyl]-2-methylguanidine (PubChem CID 111140989) has the molecular formula C18H30N6O2S and a molecular weight of 394.55 g/mol. Its IUPAC name is 1-(1,1-dioxothiolan-3-yl)-3-[[2-(4-ethylpiperazin-1-yl)-4-pyridinyl]methyl]-2-methylguanidine.
| Compound Name | 1-(1,1-dioxothiolan-3-yl)-3-[[2-(4-ethylpiperazin-1-yl)-4-pyridinyl]methyl]-2-methylguanidine |
|---|---|
| PubChem CID | 111140989 |
| Molecular Formula | C18H30N6O2S |
| Molecular Weight | 394.55 g/mol |
| Exact Mass | 394.22 |
| IUPAC Name | 1-(1,1-dioxothiolan-3-yl)-3-[[2-(4-ethylpiperazin-1-yl)-4-pyridinyl]methyl]-2-methylguanidine |
| SMILES | CCN1CCN(c2cc(CN/C(=N\C)NC3CCS(=O)(=O)C3)ccn2)CC1 |
| InChI | InChI=1S/C18H30N6O2S/c1-3-23-7-9-24(10-8-23)17-12-15(4-6-20-17)13-21-18(19-2)22-16-5-11-27(25,26)14-16/h4,6,12,16H,3,5,7-11,13-14H2,1-2H3,(H2,19,21,22) |
| InChIKey | QTWNKVUDJAZPIN-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 89.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.55 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|