C19H30FN5O2S — CID 111761123
1-(1,1-dioxothiolan-3-yl)-3-[[4-(4-ethylpiperazin-1-yl)-3-fluorophenyl]methyl]-2-methylguanidine (PubChem CID 111761123) has the molecular formula C19H30FN5O2S and a molecular weight of 411.55 g/mol. Its IUPAC name is 1-(1,1-dioxothiolan-3-yl)-3-[[4-(4-ethylpiperazin-1-yl)-3-fluorophenyl]methyl]-2-methylguanidine.
| Compound Name | 1-(1,1-dioxothiolan-3-yl)-3-[[4-(4-ethylpiperazin-1-yl)-3-fluorophenyl]methyl]-2-methylguanidine |
|---|---|
| PubChem CID | 111761123 |
| Molecular Formula | C19H30FN5O2S |
| Molecular Weight | 411.55 g/mol |
| Exact Mass | 411.21 |
| IUPAC Name | 1-(1,1-dioxothiolan-3-yl)-3-[[4-(4-ethylpiperazin-1-yl)-3-fluorophenyl]methyl]-2-methylguanidine |
| SMILES | CCN1CCN(c2ccc(CN/C(=N\C)NC3CCS(=O)(=O)C3)cc2F)CC1 |
| InChI | InChI=1S/C19H30FN5O2S/c1-3-24-7-9-25(10-8-24)18-5-4-15(12-17(18)20)13-22-19(21-2)23-16-6-11-28(26,27)14-16/h4-5,12,16H,3,6-11,13-14H2,1-2H3,(H2,21,22,23) |
| InChIKey | IGTHZNLRYWKMOU-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 77.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.55 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|