C17H26N4O2S2 — CID 111140475
1-(1,1-dioxothiolan-3-yl)-2-methyl-3-[(4-thiomorpholin-4-ylphenyl)methyl]guanidine (PubChem CID 111140475) has the molecular formula C17H26N4O2S2 and a molecular weight of 382.56 g/mol. Its IUPAC name is 1-(1,1-dioxothiolan-3-yl)-2-methyl-3-[(4-thiomorpholin-4-ylphenyl)methyl]guanidine.
| Compound Name | 1-(1,1-dioxothiolan-3-yl)-2-methyl-3-[(4-thiomorpholin-4-ylphenyl)methyl]guanidine |
|---|---|
| PubChem CID | 111140475 |
| Molecular Formula | C17H26N4O2S2 |
| Molecular Weight | 382.56 g/mol |
| Exact Mass | 382.15 |
| IUPAC Name | 1-(1,1-dioxothiolan-3-yl)-2-methyl-3-[(4-thiomorpholin-4-ylphenyl)methyl]guanidine |
| SMILES | C/N=C(\NCc1ccc(N2CCSCC2)cc1)NC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C17H26N4O2S2/c1-18-17(20-15-6-11-25(22,23)13-15)19-12-14-2-4-16(5-3-14)21-7-9-24-10-8-21/h2-5,15H,6-13H2,1H3,(H2,18,19,20) |
| InChIKey | RTCODPYJYIKAFC-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.56 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|